14-Norlanosterol(CAT: R021701) is a key sterol intermediate in the biosynthesis of cholesterol and other sterols within the body. It is structurally similar to lanosterol but lacks a methyl group at the C-14 position, which gives it unique properties in sterol metabolism. This compound is important in studying the sterol biosynthesis pathway, particularly in understanding how sterols are converted into cholesterol and related molecules. 14-Norlanosterol is also used in research focused on developing inhibitors for cholesterol biosynthesis, making it valuable for pharmaceutical and biochemical investigations into cholesterol-related diseases.
| Catalog Number | R021701 |
| CAS Number | 7448-02-4 |
| Synonyms | (3β,5α)-4,4-Dimethylcholesta-8,24-dien-3-ol; 4,4-Dimethyl5α-cholesta-8,24-dien-3β-ol; 14α-Demethyllanosterol; 4,4-Dimethylcholesta-8,24-dienol; 4,4-Dimethylzymosterol; T-MAS; Testis meiosis-activating Sterol; |
| Molecular Formula | C29H48O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C29H48O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h9,20,22-23,25-26,30H,8,10-18H2,1-7H3/t20-,22-,23+,25+,26+,28-,29-/m1/s1 |
| InChIKey | CHGIKSSZNBCNDW-QGBOJXOESA-N |
| SMILES | C[C@H](CCC=C(C)C)[C@H]1CC[C@@H]2[C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Dyke, Stanley Frederick. <i style=”font-family: Arial, sans-serif; font-size: 13px;”>The chemistry of the vitamins</i>. No. QP801. V5 D95. 1965.<br /> |
