For research use only. Not for therapeutic Use.
1,4-Pentadien-3-ol(CAT: R042896) is a chemical compound with relevance in organic synthesis and chemical research. It is an unsaturated alcohol that can serve as a precursor or intermediate in various chemical reactions. While it may not have direct applications in pharmaceuticals, cosmetics, or other industries on its own, its role as a versatile building block in organic chemistry is significant.
| Catalog Number | R042896 |
| CAS Number | 922-65-6 |
| Synonyms | 3-Hydroxy-1,4-pentadiene; Diethenylmethyl Alcohol; Divinylcarbinol; Divinylmethanol |
| Molecular Formula | C5H8O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | penta-1,4-dien-3-ol |
| InChI | InChI=1S/C5H8O/c1-3-5(6)4-2/h3-6H,1-2H2 |
| InChIKey | ICMWSAALRSINTC-UHFFFAOYSA-N |
| SMILES | C=CC(C=C)O |
