For research use only. Not for therapeutic Use.
1,4-Piperazinediethylamine is a chemical compound. It features a piperazine ring with two ethylamine groups attached. This compound is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and polymers. Its versatility in forming various chemical bonds makes it valuable in creating complex molecules for drug development and other industrial applications.
Catalog Number | R028065 |
CAS Number | 6531-38-0 |
Synonyms | 1,4-Bis(2-aminoethyl)-1,4-diazacyclohexane; 1,4-Bis(2-aminoethyl)piperazine; N,N’-Bis(2-aminoethyl)piperazine; [2-[4-(2-Aminoethyl)piperazin-1-yl]ethyl]amine; 1,4-Piperazinediethanamine |
Molecular Formula | C8H20N4 |
Purity | ≥95% |
Storage | Desiccate at -20 ℃ |
IUPAC Name | 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine |
InChI | InChI=1S/C8H20N4/c9-1-3-11-5-7-12(4-2-10)8-6-11/h1-10H2 |
InChIKey | PAOXFRSJRCGJLV-UHFFFAOYSA-N |
SMILES | C1CN(CCN1CCN)CCN |