For research use only. Not for therapeutic Use.
14,15-Leukotriene D4 is a bioactive lipid mediator derived from arachidonic acid through the lipoxygenase pathway. It is part of the leukotriene family, which plays a significant role in inflammatory and allergic responses, including bronchoconstriction, increased vascular permeability, and recruitment of immune cells. Leukotriene D4, in particular, is known for its potent effects on smooth muscle contraction and vascular permeability, making it a key target in the study of asthma, allergies, and other inflammatory conditions, as well as a potential therapeutic target.
CAS Number | 75290-64-1 |
Synonyms | Eoxin D4;EXD4;14,15-LTD4 |
Molecular Formula | C25H40N2O6S |
Purity | ≥95% |
Storage | -80°C |
InChI | InChI=1S/C25H40N2O6S/c1-2-3-12-15-21(28)22(34-19-20(26)25(33)27-18-24(31)32)16-13-10-8-6-4-5-7-9-11-14-17-23(29)30/h4,6-10,13,16,20-22,28H,2-3,5,11-12,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b6-4-,9-7-,10-8+,16-13+/t20-,21-,22+/m0/s1 |
InChIKey | BUTLPEVGZIRJOA-SPCGXPCUSA-N |
SMILES | CCCCC[C@H](O)[C@H](SC[C@H](N)C(NCC(O)=O)=O)/C=C/C=C/C=CC/C=CCCCC(O)=O |