For research use only. Not for therapeutic Use.
1,5-Dichloro-3-methyl-2-nitrobenzene is a high-purity organic compound widely used in pharmaceutical and chemical research. Its unique structure, featuring chlorine, methyl, and nitro groups on a benzene ring, makes it valuable for synthesis applications, especially in the development of intermediates for drug manufacturing. It serves as a key building block in the preparation of various agrochemicals, pharmaceuticals, and fine chemicals. Ideal for synthetic chemistry studies, 1,5-Dichloro-3-methyl-2-nitrobenzene offers versatility in diverse research fields.
CAS Number | 118665-00-2 |
Molecular Formula | C7H5Cl2NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,5-dichloro-3-methyl-2-nitrobenzene |
InChI | InChI=1S/C7H5Cl2NO2/c1-4-2-5(8)3-6(9)7(4)10(11)12/h2-3H,1H3 |
InChIKey | SGSOOBQNRQUSIL-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |