For research use only. Not for therapeutic Use.
1,5-Difluoro-2-methyl-4-nitrobenzene is a fluorinated aromatic compound often utilized in pharmaceutical and materials science research. Featuring two fluorine atoms, a nitro group, and a methyl substituent, this compound provides a stable yet reactive framework suitable for the synthesis of more complex molecules. Its structure supports applications in drug discovery, where it acts as an intermediate for developing fluorinated bioactive compounds. Additionally, it’s useful in designing materials with unique electronic and chemical properties, aiding advancements in medicinal and industrial chemistry.
CAS Number | 179011-38-2 |
Molecular Formula | C7H5F2NO2 |
Purity | ≥95% |
IUPAC Name | 1,5-difluoro-2-methyl-4-nitrobenzene |
InChI | InChI=1S/C7H5F2NO2/c1-4-2-7(10(11)12)6(9)3-5(4)8/h2-3H,1H3 |
InChIKey | BVVAZYONIKSNFT-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |