For research use only. Not for therapeutic Use.
1,5-Difluoro-3-methoxy-2-nitrobenzene(Cat No.:L033068)is a key intermediate used in the synthesis of pharmaceuticals and agrochemicals. The presence of both fluorine and nitro groups enhances its reactivity, making it valuable for creating complex molecules with potential biological activity. The methoxy group adds further versatility, allowing for diverse chemical transformations. This compound is particularly useful in the design of bioactive compounds, including enzyme inhibitors and receptor ligands. Researchers rely on its high purity and stability to explore new synthetic pathways and develop innovative therapeutic and agricultural products.
CAS Number | 66684-61-5 |
Molecular Formula | C7H5F2NO3 |
Purity | ≥95% |
IUPAC Name | 1,5-difluoro-3-methoxy-2-nitrobenzene |
InChI | InChI=1S/C7H5F2NO3/c1-13-6-3-4(8)2-5(9)7(6)10(11)12/h2-3H,1H3 |
InChIKey | DXEGOHULGVHKCT-UHFFFAOYSA-N |
SMILES | COC1=C(C(=CC(=C1)F)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |