For research use only. Not for therapeutic Use.
1,5-Diisocyanatonaphthalene(Cat No.:L006978), is an organic compound featuring two isocyanate (-NCO) functional groups attached to a naphthalene ring. It is a yellow-to-orange solid, highly reactive due to the presence of isocyanate groups. This compound is utilized as a cross-linking agent and building block in the synthesis of polyurethane resins, adhesives, and coatings. Its reactivity and ability to form strong covalent bonds with various substrates make it valuable in the production of durable materials. 1,5-Diisocyanatonaphthalene plays a significant role in polymer chemistry, contributing to the development of diverse polyurethane-based products in industrial applications.
CAS Number | 3173-72-6 |
Molecular Formula | C12H6N2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1,5-diisocyanatonaphthalene |
InChI | InChI=1S/C12H6N2O2/c15-7-13-11-5-1-3-9-10(11)4-2-6-12(9)14-8-16/h1-6H |
InChIKey | SBJCUZQNHOLYMD-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=C2N=C=O)C(=C1)N=C=O |