For research use only. Not for therapeutic Use.
15-<wbr></wbr>keto Prostaglandin E<sub>2</sub> (15-<wbr></wbr>keto PGE<sub>2</sub>) is a metabolite of PGE<sub>2</sub> formed by 15-<wbr></wbr>hydroxy PGDH. <em>In vivo</em>, 15-<wbr></wbr>keto PGE<sub>2</sub> is essentially inactive. It has an attenuated affinity for the EP<sub>4</sub> and EP<sub>2</sub> receptors compared to PGE<sub>2</sub> (K<sub>i</sub> = 2,600-<wbr></wbr>15,000 nM for the inhibition of PGE<sub>2</sub> binding compared to a K<sub>d</sub> = 1 nM for PGE<sub>2</sub>).
CAS Number | 26441-05-4 |
Synonyms | (5Z,11α,13E)-11-Hydroxy-9,15-dioxoprosta-5,13-dien-1-oic Acid; 15-Dehydroprostaglandin E2; 7-[3-Hydroxy-5-oxo-2-(3-oxo-1-octenyl)cyclopentyl]-5-heptenoic Acid; 15-Keto PGE2; 15-Ketoprostaglandin E2; 15-Oxo-PGE2; 15-Oxoprostaglandin E2; 15-Keto-PGE2; |
Molecular Formula | C20H30O5 |
Purity | ≥95% |
Documentation | |
Target | JAK/STAT Signaling |
Storage | -20°C |
IUPAC Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-5-oxo-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoic acid |
InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-17,19,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t16-,17-,19-/m1/s1 |
InChIKey | YRTJDWROBKPZNV-KMXMBPPJSA-N |
SMILES | CCCCCC(=O)C=CC1C(CC(=O)C1CC=CCCCC(=O)O)O |