For research use only. Not for therapeutic Use.
15(R)-<wbr></wbr>PGF<sub>2α</sub> is the C-<wbr></wbr>15 epimer of the naturally occurring mammalian autacoid PGF<sub>2α</sub>. It has only 25% of the potency of PGF<sub>2α</sub> in hamster antifertility studies, which may be due to reduced affinity for FP receptors. Compared to PGF<sub>2α</sub>, 15(R)-<wbr></wbr>PGF<sub>2α</sub> has a binding affinity of 6.7% to ovine luteal cell receptors. Similarly, the binding affinity to rat vascular smooth muscle cells is negligible as compared to PGF<sub>2α</sub>.
| Catalog Number | R065324 |
| CAS Number | 37658-84-7 |
| Synonyms | 15-epi PGF2α |
| Molecular Formula | C20H34O5 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | PXGPLTODNUVGFL-CKXCCYAOSA-N |
| SMILES | O[C@@H]1[C@H](C/C=CCCCC(O)=O)[C@@H](/C=C/[C@H](O)CCCCC)[C@H](O)C1 |
| Reference | 1.Miller, W.L., and Sutton, M.J. Relative biological activity of certain prostaglandins and their enantiomers. Prostaglandins 11, 77-84 (1976). |
