For research use only. Not for therapeutic Use.
1,5,6,7-Tetrahydro-4H-indol-4-one is a heterocyclic organic compound featuring a partially saturated indole ring system with a ketone group at the 4-position. This compound is used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. Its unique structure allows for versatile chemical modifications, making it valuable for creating bioactive molecules. Additionally, it is studied for its potential role in the synthesis of novel therapeutic agents and in medicinal chemistry research.
CAS Number | 13754-86-4 |
Synonyms | 6,7-Dihydroindol-4(5H)-one; 1,5,6,7-Tetrahydroindol-4-one; 4,5,6,7-Tetrahydro-4-indolone; 4,5,6,7-Tetrahydro-4-oxoindole; 4-Oxo-4,5,6,7-tetrahydroindole; 6,7-Dihydro-1H-indol-4(5H)-one; NSC 131681; |
Molecular Formula | C8H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,5,6,7-tetrahydroindol-4-one |
InChI | InChI=1S/C8H9NO/c10-8-3-1-2-7-6(8)4-5-9-7/h4-5,9H,1-3H2 |
InChIKey | KASJZXHXXNEULX-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CN2)C(=O)C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |