For research use only. Not for therapeutic Use.
1,6-Bis(maleimide)hexane (Cat No.:R000712) is a chemical compound. It consists of a hexane backbone with two maleimide groups (-C4H2NCO-) attached at positions 1 and 6. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Bis(maleimide) compounds like this are commonly used as cross-linking agents in bioconjugation reactions, particularly for linking thiol-containing molecules such as proteins and peptides.
Catalog Number | R000712 |
CAS Number | 4856-87-5 |
Synonyms | 1,1’-(1,6-Hexanediyl)bis-1H-pyrrole-2,5-dione; 1,6-Maleimidohexane; GMBMI; N,N’-Hexamethylenebis[maleimide]; N,N’-Hexamethylenedimaleimide; NSC 12818;?BMH |
Molecular Formula | C14H16N2O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione |
InChI | InChI=1S/C14H16N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-16-13(19)7-8-14(16)20/h5-8H,1-4,9-10H2 |
InChIKey | PYVHLZLQVWXBDZ-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCCCCCN2C(=O)C=CC2=O |