For research use only. Not for therapeutic Use.
1,6-Dihydro-4-hydroxy-2-methyl-6-oxonicotinonitrile (CAT: L000174) is a notable chemical compound with applications in organic chemistry and pharmaceutical research. Its action mechanism involves serving as an essential intermediate for various chemical reactions. In organic chemistry, this compound is a versatile building block for the synthesis of pharmaceutical intermediates. It plays a significant role in the design and development of potential drugs, particularly in the pharmaceutical industry, enabling the creation of novel therapeutic molecules.
CAS Number | 64169-92-2 |
Molecular Formula | C7H6N2O2 |
Purity | ≥95% |
IUPAC Name | 4-hydroxy-2-methyl-6-oxo-1H-pyridine-3-carbonitrile |
InChI | InChI=1S/C7H6N2O2/c1-4-5(3-8)6(10)2-7(11)9-4/h2H,1H3,(H2,9,10,11) |
InChIKey | OLTATMRIIFNCTG-UHFFFAOYSA-N |