Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1,6-Dimethyl-1H-pyrazolo[4,3-d]pyrimidine-5,7(4H,6H)-dione
For research use only. Not for therapeutic Use.
1,6-Dimethyl-1H-pyrazolo[4,3-d]pyrimidine-5,7(4H,6H)-dione(CAT: L000367) is a key compound in the field of organic chemistry. Its structure contains a unique pyrazolo-pyrimidine core, which is a valuable scaffold in the design and synthesis of bioactive molecules. In the realm of organic chemistry, it serves as a versatile building block for the creation of various heterocyclic compounds. Researchers often use it to develop novel chemical entities with diverse applications, including potential pharmaceutical agents or materials with specific properties.
CAS Number | 56536-24-4 |
Molecular Formula | C7H8N4O2 |
Purity | ≥95% |
IUPAC Name | 1,6-dimethyl-4H-pyrazolo[4,3-d]pyrimidine-5,7-dione |
InChI | InChI=1S/C7H8N4O2/c1-10-6(12)5-4(9-7(10)13)3-8-11(5)2/h3H,1-2H3,(H,9,13) |
InChIKey | DOTCEVYMJKRBTL-UHFFFAOYSA-N |