For research use only. Not for therapeutic Use.
1,6-Dimethyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde(Cat No.:L025612)is a heterocyclic compound featuring a fused pyrrolo-pyridine ring system with methyl groups at the 1 and 6 positions and an aldehyde group at the 3 position. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate in the development of biologically active molecules, including potential drug candidates. Its unique structure allows for versatile reactivity in various chemical transformations, making it valuable for creating complex heterocyclic compounds in medicinal chemistry and material science applications.
CAS Number | 1368175-67-0 |
Molecular Formula | C10H10N2O |
Purity | ≥95% |
IUPAC Name | 1,6-dimethylpyrrolo[2,3-b]pyridine-3-carbaldehyde |
InChI | InChI=1S/C10H10N2O/c1-7-3-4-9-8(6-13)5-12(2)10(9)11-7/h3-6H,1-2H3 |
InChIKey | WEXPRIHZKVEZLZ-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C(=CN2C)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |