For research use only. Not for therapeutic Use.
1,6-Divinylperfluorohexane (Cat No.:M119264) is a chemical compound. It consists of a hexane backbone with two vinyl groups (-CH=CH2) attached at positions 1 and 6, and all hydrogen atoms substituted by fluorine. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Divinylperfluorohexane is often used as a monomer in polymerization processes to create fluorinated polymers with unique properties, such as resistance to harsh chemicals and extreme temperatures. Its structure contributes to the polymer’s exceptional properties, supporting advancements in materials science and industrial applications.
CAS Number | 1800-91-5 |
Molecular Formula | C10H6F12 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene |
InChI | InChI=1S/C10H6F12/c1-3-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-2/h3-4H,1-2H2 |
InChIKey | PDFSXHZXNZCKNF-UHFFFAOYSA-N |
SMILES | C=CC(C(C(C(C(C(C=C)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |