For research use only. Not for therapeutic Use.
1,6-Hexanediol Diglycidyl Ether(Cat No.:M083675)is a high-purity bifunctional epoxy compound widely used in polymer and material science research. It acts as a crosslinking agent, enhancing the mechanical properties and durability of polymers, coatings, and adhesives. Its precise reactivity makes it valuable for developing advanced materials with improved thermal and chemical resistance. Additionally, it is used in the synthesis of specialty resins and as a modifier in epoxy systems. This versatile compound is essential for innovations in industrial applications, contributing to the creation of high-performance materials.
CAS Number | 16096-31-4 |
Synonyms | 1,6-Bis(2,3-epoxypropoxy)hexane; Oxirane, 2,2′-[1,6-hexanediylbis(oxymethylene)]bis-; 1,6-Bis(oxiran-2-ylmethoxy)hexane |
Molecular Formula | C12H22O4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-[6-(oxiran-2-ylmethoxy)hexoxymethyl]oxirane |
InChI | InChI=1S/C12H22O4/c1(3-5-13-7-11-9-15-11)2-4-6-14-8-12-10-16-12/h11-12H,1-10H2 |
InChIKey | WTYYGFLRBWMFRY-UHFFFAOYSA-N |
SMILES | C1C(O1)COCCCCCCOCC2CO2 |