For research use only, not for therapeutic use.
1,6-Naphthyridine-8-carboxylic acid(Cat No.:L006825), is an important chemical compound with applications in medicinal and organic chemistry. Its molecular structure contains a naphthyridine ring with a carboxylic acid functional group at the 8th position. Scientists utilize this compound and its derivatives in the development of pharmaceuticals, as it serves as a core structure in the synthesis of potential drugs and bioactive molecules.
Catalog Number | L006825 |
CAS Number | 362606-19-7 |
Molecular Formula | C9H6N2O2 |
Purity | ≥95% |
IUPAC Name | 1,6-naphthyridine-8-carboxylic acid |
InChI | InChI=1S/C9H6N2O2/c12-9(13)7-5-10-4-6-2-1-3-11-8(6)7/h1-5H,(H,12,13) |
InChIKey | WERVZPSGADOFEJ-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=CC(=C2N=C1)C(=O)O |