For research use only. Not for therapeutic Use.
17β-Estradiol-d2(Cat No.:R067693) is a high-purity, deuterium-labeled compound crucial for advanced pharmaceutical and biochemical research. Featuring two deuterium atoms, this isotopically labeled version of 17β-Estradiol is essential for hormone metabolism studies, receptor binding assays, and endocrine research. This compound offers enhanced stability and reproducibility, making it ideal for experimental setups requiring high precision. 17β-Estradiol-d2 is a valuable tool for scientific investigations, aiding in the development of hormone-related therapies and enhancing our understanding of hormonal regulation.
Catalog Number | R067693 |
CAS Number | 53866-33-4 |
Synonyms | 2,4-Dideuteriostradiol;E2-d2;Estradiol-d2;β-Estradiol-d2;17β-Oestradiol-d2 |
Molecular Formula | C18H24O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (8R,9S,13S,14S,17S)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i3D,10D |
InChIKey | VOXZDWNPVJITMN-JXCLBMSPSA-N |
SMILES | [2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C)C(=C1O)[2H] |