For research use only. Not for therapeutic Use.
(17β)-Spiro[androsta-1,4-diene-17,2’-oxiran]-3-one(Cat No.:R040037)is a synthetic steroidal compound characterized by a unique spiro-oxirane ring fused to an androstadiene backbone. This structural feature imparts significant biological activity, making it a valuable compound in medicinal chemistry. It exhibits potential anti-inflammatory, anti-proliferative, and anti-cancer properties, with applications in hormone-related therapies and cancer treatment. Its ability to interact with steroid receptors and enzymes underlies its pharmacological effects. The compound’s unique configuration also allows for further chemical modifications, aiding the development of new therapeutic agents targeting various diseases.
CAS Number | 55706-91-7 |
Synonyms | Spiro[17H-cyclopenta[a]phenanthrene-17,2’-oxirane] |
Molecular Formula | C₂₀H₂₆O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (8R,9S,10R,13S,14R,17S)-10,13-dimethylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,2'-oxirane]-3-one |
InChI | InChI=1S/C20H26O2/c1-18-8-5-14(21)11-13(18)3-4-15-16(18)6-9-19(2)17(15)7-10-20(19)12-22-20/h5,8,11,15-17H,3-4,6-7,9-10,12H2,1-2H3/t15-,16+,17-,18+,19+,20-/m1/s1 |
InChIKey | BDTGTVDLVOUNEQ-XHYRXIGBSA-N |
SMILES | CC12CCC3C(C1CCC24CO4)CCC5=CC(=O)C=CC35C |