For research use only. Not for therapeutic Use.
17-Dehydroxy Prednisolone is a high-purity steroid derivative essential for advanced pharmaceutical and biochemical research. This compound is crucial for studies involving glucocorticoid activity, anti-inflammatory mechanisms, and hormone metabolism. Known for its stability and specific biological activity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| Catalog Number | R019273 |
| CAS Number | 13479-38-4 |
| Synonyms | Prednisolone Impurity I, 1,2-Didehydrocorticosterone; 1-Dehydrocorticosterone; 11β,21-Dihydroxypregna-1,4-diene-3,20-dione; 17-Deoxyprednisolone; Δ1-Corticosterone; |
| Molecular Formula | C21H28O4 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H28O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h7-9,14-17,19,22,24H,3-6,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1 |
| InChIKey | ZFQSDPPADTWKDI-HJTSIMOOSA-N |
| SMILES | CC12CC(C3C(C1CCC2C(=O)CO)CCC4=CC(=O)C=CC34C)O |
