For research use only. Not for therapeutic Use.
17-Deoxy cortienic acid is a steroid compound that serves as a precursor in the synthesis of various corticosteroids, including cortisol and cortisone. This molecule lacks the hydroxyl group at the 17th position, distinguishing it from other corticosteroids. Understanding its chemical properties and reactions is essential in pharmaceutical research for the production of medications used to treat inflammatory and autoimmune conditions, among other medical applications.
CAS Number | 2394-25-4 |
Synonyms | 11β-Hydroxy-3-oxo-androst-4-ene-17β-carboxylic Acid; 11β-Hydroxy-3-oxoandrost-4-ene-17β-carboxylic Acid; |
Molecular Formula | C20H28O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
InChI | InChI=1S/C20H28O4/c1-19-8-7-12(21)9-11(19)3-4-13-14-5-6-15(18(23)24)20(14,2)10-16(22)17(13)19/h9,13-17,22H,3-8,10H2,1-2H3,(H,23,24)/t13-,14-,15+,16-,17+,19-,20-/m0/s1 |
InChIKey | XEFVQCSDIKHROY-SEMYFXIOSA-N |
SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)O)C)O |