For research use only. Not for therapeutic Use.
1,7-Diaminoheptane, N-amidino-(Cat No.:M092500)is a bifunctional aliphatic compound featuring amino groups at both ends of a seven-carbon chain and an amidino group. This structure makes it a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and polymers. The compound is particularly useful in developing guanidine derivatives, which are important in medicinal chemistry for creating bioactive molecules, including enzyme inhibitors and other therapeutic agents. Its flexible carbon chain and reactive functional groups allow for various chemical modifications, making it essential in drug discovery and advanced organic synthesis.
CAS Number | 150333-69-0 |
Synonyms | 1,7-Diaminoheptane, N-amidino- |
Molecular Formula | C8H20N4 |
Purity | ≥95% |
IUPAC Name | 2-(7-aminoheptyl)guanidine |
InChI | InChI=1S/C8H20N4/c9-6-4-2-1-3-5-7-12-8(10)11/h1-7,9H2,(H4,10,11,12) |
InChIKey | YAOAMZOGXBMLFQ-UHFFFAOYSA-N |
SMILES | C(CCCN)CCCN=C(N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |