For research use only. Not for therapeutic Use.
17-Phenyl Trinor Prostaglandin F2α Methyl Amide(CAT: R017492) is a synthetic analog of prostaglandin F2α (PGF2α), which plays a key role in modulating various physiological processes such as uterine contractions, vasoconstriction, and the regulation of intraocular pressure. This analog has been structurally modified to enhance its biological stability and activity, making it useful in pharmaceutical research. It is often studied for its potential therapeutic applications in ophthalmology, particularly in the treatment of glaucoma due to its ability to lower intraocular pressure. Additionally, it may be used in reproductive biology research to explore its effects on uterine muscle activity.
| Catalog Number | R017492 |
| CAS Number | 155206-01-2 |
| Molecular Formula | C24H35NO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylhept-5-enamide |
| InChI | InChI=1S/C24H35NO4/c1-25-24(29)12-8-3-2-7-11-20-21(23(28)17-22(20)27)16-15-19(26)14-13-18-9-5-4-6-10-18/h2,4-7,9-10,15-16,19-23,26-28H,3,8,11-14,17H2,1H3,(H,25,29)/b7-2-,16-15+/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | UWIWNJFBNIMMGY-FDBOBMRISA-N |
| SMILES | CNC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC=CC=C2)O)O)O |
