For research use only. Not for therapeutic Use.
17(R)-Resolvin D1(CAT: R060917) is a bioactive lipid mediator derived from the omega-3 fatty acid docosahexaenoic acid (DHA). It plays a crucial role in resolving inflammation and promoting tissue healing by acting on specific receptors involved in inflammatory responses. 17(R)-Resolvin D1 exerts anti-inflammatory effects by reducing the recruitment of inflammatory cells and promoting the clearance of inflammatory debris. This specialized pro-resolving mediator (SPM) is studied for its therapeutic potential in treating chronic inflammatory diseases, such as cardiovascular disease, neurodegenerative disorders, and autoimmune conditions. Its ability to resolve inflammation without immunosuppression makes it a promising target for drug development.
Catalog Number | R060917 |
CAS Number | 528583-91-7 |
Synonyms | Aspirin-triggered Resolvin D1;17-epi-Resolvin D1;AT-RvD1;17(R)-RvD1 |
Molecular Formula | C22H32O5 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -80°C |
IUPAC Name | 7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoic acid |
InChI | InChI=1S/C22H32O5/c1-2-3-9-14-19(23)15-10-6-4-5-7-11-16-20(24)21(25)17-12-8-13-18-22(26)27/h3-12,15-16,19-21,23-25H,2,13-14,17-18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,12-8-,15-10+,16-11+/t19-,20-,21+/m1/s1 |
InChIKey | OIWTWACQMDFHJG-BJEBZIPWSA-N |
SMILES | CC/C=CC[C@@H](O)C=CC=CC=C/C=C[C@@H](O)C(O)C/C=CCCC(=O)O |