For research use only. Not for therapeutic Use.
17-Trifluoromethylphenyl trinor Prostaglandin F2α(CAT: R065376) is a synthetic analog of Prostaglandin F2α (PGF2α), a naturally occurring prostaglandin involved in various physiological processes such as smooth muscle contraction, regulation of blood flow, and modulation of inflammation. The introduction of a trifluoromethylphenyl group enhances the compound’s stability and bioactivity, making it useful in research and potential therapeutic applications. This analog is particularly relevant in studying the effects of prostaglandins on the reproductive system, including their roles in labor induction, luteolysis, and treatment of glaucoma. Additionally, it may be explored for its potential in modulating inflammatory responses. The structural modifications in 17-trifluoromethylphenyl trinor Prostaglandin F2α allow for the investigation of prostaglandin receptor interactions and the development of new prostaglandin-based drugs.
CAS Number | 221246-34-0 |
Synonyms | 17-trifluoromethylphenyl trinor PGF2α |
Molecular Formula | C24H31O5F3 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C24H31F3O5/c25-24(26,27)17-7-5-6-16(14-17)10-11-18(28)12-13-20-19(21(29)15-22(20)30)8-3-1-2-4-9-23(31)32/h1,3,5-7,12-14,18-22,28-30H,2,4,8-11,15H2,(H,31,32)/b3-1-,13-12+/t18-,19+,20+,21-,22+/m0/s1 |
InChIKey | CMLNDCUXASGBMQ-NQUQXYBYSA-N |
SMILES | O[C@@H]1[C@H](C/C=CCCCC(O)=O)[C@@H](/C=C/[C@@H](O)CCC2=CC(C(F)(F)F)=CC=C2)[C@H](O)C1 |
Reference | 1.Woodward, D.F.,Krauss, A.H.P.,Chen, J., et al. The pharmacology of Bimatoprost (Lumigan™). Survey of Ophthalmology 45, S337-S345 (2001). |