For research use only. Not for therapeutic Use.
17,21-Dihydroxypregna-1,4,9(11)-triene-3,20-dione (Cat No.:C001102) is a synthetic corticosteroid compound with a pregnane structure. It contains two hydroxy groups at positions 17 and 21 and a ketone group at position 3. This compound may have potential applications in pharmaceutical research due to its similarity to naturally occurring hormones involved in various physiological processes.
| Catalog Number | C001102 |
| CAS Number | 10184-69-7 |
| Synonyms | Deltacortinene; EP Prednisone Impurity D; |
| Molecular Formula | C₂₁H₂₆O₄ |
| Purity | ≥95% |
| Solubility | Ethyl Acetate (Slightly), Methanol (Slightly), Pyridine (Slightly) |
| Appearance | White to Pale Yellow Solid |
| Storage | 4°C |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| InChI | (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| InChIKey | (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC=C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC43C |
| Reference | Rousseau, G. et al.: J. Ster. Biochem., 8, 911 (1977); |
