For research use only. Not for therapeutic Use.
17α-Hydroxy Pregnenolone-d3(Cat No.:R006782) is a deuterated form of 17α-Hydroxy Pregnenolone, where three hydrogen atoms are replaced with deuterium. This isotopic labeling enhances its stability and makes it invaluable for studying steroid metabolism and endocrine pathways. It is extensively used in research to understand hormonal balance and synthesis in conditions such as adrenal disorders and reproductive issues. The deuterated compound aids in sensitive and precise quantification in mass spectrometry, improving the accuracy of hormonal assays and contributing to the development of targeted therapies for endocrine-related diseases.
Catalog Number | R006782 |
CAS Number | 105078-92-0 |
Synonyms | (3β)-3,17-dihydroxypregn-5-en-20-one; 17α-Hydroxypregnenolone-21,21,21-d3; β,17-Dihydroxy-5-pregnen-20-one; 5-Pregnen-3β,17α-diol-20-one; NSC 63853; |
Molecular Formula | C21H32O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | 2°C to 8°C |
IUPAC Name | 2,2,2-trideuterio-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
InChI | InChI=1S/C21H32O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h4,15-18,23-24H,5-12H2,1-3H3/t15-,16+,17-,18-,19-,20-,21-/m0/s1/i1D3 |
InChIKey | JERGUCIJOXJXHF-DBAXYKBZSA-N |
SMILES | [2H]C([2H])([2H])C(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O |