For research use only. Not for therapeutic Use.
17α-Hydroxy Progesterone-d8(Cat No.:R012337) is a deuterated version of 17α-Hydroxy Progesterone, where eight hydrogen atoms are replaced with deuterium, significantly enhancing its chemical stability. This isotopic labeling is crucial for detailed studies of steroid metabolism, particularly in the context of adrenal and reproductive health. It facilitates precise and sensitive detection in analytical assays, such as mass spectrometry, used in clinical diagnostics and pharmaceutical research. This compound is instrumental in investigating disorders like congenital adrenal hyperplasia monitoring therapeutic interventions, ensuring accurate hormonal assessments, and contributing to more effective treatment strategies.
CAS Number | 850023-80-2 |
Synonyms | 17-Hydroxy-pregn-4-ene-3,20-dione-d8; 4-Pregnen-17α-ol-3,20-dione-d8; |
Molecular Formula | C21H30O3 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | (8R,9S,10R,13S,14S,17R)-2,2,4,6,6-pentadeuterio-17-hydroxy-10,13-dimethyl-17-(2,2,2-trideuterioacetyl)-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1/i1D3,4D2,6D2,12D |
InChIKey | DBPWSSGDRRHUNT-LDLLURODSA-N |
SMILES | [2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3CC2([2H])[2H])CC[C@@]4(C(=O)C([2H])([2H])[2H])O)C)C |