For research use only. Not for therapeutic Use.
1,8-Diaminonaphthalene(CAT: R029318) is an aromatic compound featuring two amino groups positioned at the 1 and 8 locations on a naphthalene ring. This compound is widely utilized in chemical and pharmaceutical research, serving as a key intermediate in the synthesis of dyes, organic semiconductors, and bioactive molecules. Its rigid aromatic framework and bifunctional amino groups make it valuable in the development of chelating agents, fluorescent probes, and enzyme inhibitors. With high purity and reactivity, 1,8-Diaminonaphthalene is a versatile building block for innovative applications in materials science, medicinal chemistry, and advanced organic synthesis.
| Catalog Number | R029318 |
| CAS Number | 479-27-6 |
| Synonyms | 1,8-Diamine Naphthaline; 1,8-Naphthylenediamine; NSC 6081 |
| Molecular Formula | C10H10N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | naphthalene-1,8-diamine |
| InChI | InChI=1S/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
| InChIKey | YFOOEYJGMMJJLS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=CC=C2)N |
