For research use only. Not for therapeutic Use.
1,8-diazacyclotetradecane-2,9-dione(CAT: M017767) is a cyclic compound with diverse applications. In pharmaceuticals, it acts as a potential drug delivery agent due to its ability to form stable complexes with metal ions, aiding in controlled drug release. Its chelating properties make it valuable in organic chemistry for coordination reactions and catalysis. In material chemistry, it finds use as a ligand in designing novel metal-organic frameworks with tunable properties for gas storage and separation. Its versatility extends to cosmetics, acting as a stabilizer in skincare formulations.
CAS Number | 56403-09-9 |
Synonyms | 1,8-diazacyclotetradecane-2,9-dione |
Molecular Formula | C12H22N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,8-diazacyclotetradecane-2,9-dione |
InChI | InChI=1S/C12H22N2O2/c15-11-7-3-1-5-9-13-12(16)8-4-2-6-10-14-11/h1-10H2,(H,13,16)(H,14,15) |
InChIKey | HERSSAVMHCMYSQ-UHFFFAOYSA-N |
SMILES | C1CCC(=O)NCCCCCC(=O)NCC1 |