For research use only. Not for therapeutic Use.
18-Hydroxycorticosterone is a steroid hormone that plays a role in the biosynthesis of aldosterone, a key regulator of sodium and potassium levels in the body. This hormone is primarily produced in the adrenal cortex and serves as an intermediate in the pathway leading to aldosterone production. The study of 18-hydroxycorticosterone is crucial for understanding aldosterone-related disorders such as hyperaldosteronism and Addison’s disease, providing insights into the regulation of blood pressure and electrolyte balance.
CAS Number | 561-65-9 |
Synonyms | (11β)-11,18,21-Trihydroxypregn-4-ene-3,20-dione; 11β,18,21-Trihydroxypregn-4-ene-3,20-dione; 18-Hydroxycorticosterone; |
Molecular Formula | C21H30O5 |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-13-(hydroxymethyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C21H30O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,14-17,19,22-23,25H,2-7,9-11H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 |
InChIKey | HFSXHZZDNDGLQN-ZVIOFETBSA-N |
SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)CO)O |