For research use only. Not for therapeutic Use.
1,8-Naphthalenedimethanol(CAT: L035523) is a high-purity aromatic compound widely used in chemical and pharmaceutical research. Featuring a naphthalene core with hydroxymethyl groups at the 1 and 8 positions, this compound serves as a versatile intermediate in the synthesis of polymers, resins, and fine chemicals. Its unique structure and reactivity make it suitable for applications in materials science, organic synthesis, and medicinal chemistry. 1,8-Naphthalenedimethanol ensures reliable performance, supporting innovation in the development of advanced materials and specialized chemical products.
Catalog Number | L035523 |
CAS Number | 2026-08-6 |
Molecular Formula | C12H12O2 |
Purity | ≥95% |
IUPAC Name | [8-(hydroxymethyl)naphthalen-1-yl]methanol |
InChI | InChI=1S/C12H12O2/c13-7-10-5-1-3-9-4-2-6-11(8-14)12(9)10/h1-6,13-14H,7-8H2 |
InChIKey | DINZUYYYXDLSJE-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)CO)C(=CC=C2)CO |