For research use only. Not for therapeutic Use.
(1E)-N, N-Dimethyl-1-buten-1-amine(Cat No.:M055272) is an organic compound that features both amine and alkene groups, indicated by its IUPAC name which emphasizes the E-configuration of the double bond. This chemical is a colorless liquid that is used primarily as a building block in organic synthesis. Its structure allows it to participate in various chemical reactions, including those involving alkylation and acylation. This compound serves as a precursor in the synthesis of pharmaceuticals, agrochemicals, and polymers by facilitating the introduction of the N, N-dimethylbutenyl moiety into more complex molecular frameworks.
CAS Number | 14548-12-0 |
Synonyms | (1E)-N,N-Dimethyl-1-buten-1-amine |
Molecular Formula | C6H13N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | (E)-N,N-dimethylbut-1-en-1-amine |
InChI | InChI=1S/C6H13N/c1-4-5-6-7(2)3/h5-6H,4H2,1-3H3/b6-5+ |
InChIKey | XWAKKPDDQPWGAQ-AATRIKPKSA-N |
SMILES | CCC=CN(C)C |