For research use only. Not for therapeutic Use.
(1E,4E)-1,5-Bis(2-Methoxyphenyl)penta-1,4-dien-3-one (CAT: M021008) is a chemical compound with potential applications in organic synthesis and material science. Its structure features two 2-methoxyphenyl groups attached to a pentadienone core, possessing interesting optical and electronic properties. Though its specific action target and pharmacologic action are not mentioned in the provided data, this compound likely serves as a versatile building block for designing and synthesizing new materials with potential applications in optoelectronics, sensors, and pharmaceutical research.
CAS Number | 39777-61-2 |
Synonyms | (1E,4E)-1,5-Bis(2-Methoxyphenyl)penta-1,4-dien-3-one;1,4-Pentadien-3-one, 1,5-bis(2-Methoxyphenyl)-, (1E,4E)- |
Molecular Formula | C19H18O3 |
Purity | ≥95% |
Target | Autophagy |
Storage | Store at -20°C |
IUPAC Name | (1E,4E)-1,5-bis(2-methoxyphenyl)penta-1,4-dien-3-one |
InChI | InChI=1S/C19H18O3/c1-21-18-9-5-3-7-15(18)11-13-17(20)14-12-16-8-4-6-10-19(16)22-2/h3-14H,1-2H3/b13-11+,14-12+ |
InChIKey | RCZMPCUUTSDNAJ-PHEQNACWSA-N |
SMILES | COC1=CC=CC=C1C=CC(=O)C=CC2=CC=CC=C2OC |