Home
>
Chemical Reagents>Organic Building Blocks>
>
(1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxybenzylidene)hepta-1,6-diene-3,5-dione
For research use only. Not for therapeutic Use.
(1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxybenzylidene)hepta-1,6-diene-3,5-dione(CAT: L000035) is a chemical compound with significant applications in organic chemistry. This compound serves as a valuable intermediate for the synthesis of various organic compounds, enabling the diversification of chemical synthesis. Its unique structure, with multiple aromatic rings and functional groups, provides opportunities for creating specialized molecules with potential uses in various areas within the field of organic chemistry.
Catalog Number | L000035 |
CAS Number | 1227098-15-8 |
Molecular Formula | C31H30O8 |
Purity | ≥95% |
IUPAC Name | (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione |
InChI | InChI=1S/C31H30O8/c1-35-27-14-9-20(17-30(27)38-4)6-11-24(32)23(16-22-8-13-26(34)29(19-22)37-3)25(33)12-7-21-10-15-28(36-2)31(18-21)39-5/h6-19,34H,1-5H3/b11-6+,12-7+ |
InChIKey | AYIYVEPNEPUJCF-GNXRPPCSSA-N |