For research use only. Not for therapeutic Use.
1H-Benzimidazole, 2-chloro-1-methyl-(9CI) is a heterocyclic compound featuring a benzimidazole core with a chlorine atom at the 2-position and a methyl group at the 1-position. This structure makes it a valuable intermediate in pharmaceutical research, often used in the synthesis of bioactive molecules. Its reactivity allows for further chemical modifications, contributing to the development of potential therapeutic agents. Gently, this compound supports advancements in medicinal chemistry, helping scientists explore new pathways in drug discovery and organic synthesis.
CAS Number | 1849-02-1 |
Molecular Formula | C8H7ClN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-1-methylbenzimidazole |
InChI | InChI=1S/C8H7ClN2/c1-11-7-5-3-2-4-6(7)10-8(11)9/h2-5H,1H3 |
InChIKey | UXZYKSFMGDWHGJ-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC=C2N=C1Cl |