For research use only. Not for therapeutic Use.
(1H-Indazol-3-yl)methanol(CAT: L024091) is a heterocyclic compound featuring an indazole core with a hydroxymethyl group at the 3-position. This versatile molecule is widely used in pharmaceutical and chemical research as a building block for synthesizing bioactive compounds, including kinase inhibitors and receptor modulators. Its unique structure offers potential applications in medicinal chemistry and drug discovery, enabling the development of novel therapeutic agents. With high purity and structural stability, (1H-Indazol-3-yl)methanol is an essential intermediate for researchers exploring innovative pathways in organic synthesis and biomedical applications.
CAS Number | 64132-13-4 |
Molecular Formula | C8H8N2O |
Purity | ≥95% |
IUPAC Name | 2H-indazol-3-ylmethanol |
InChI | InChI=1S/C8H8N2O/c11-5-8-6-3-1-2-4-7(6)9-10-8/h1-4,11H,5H2,(H,9,10) |
InChIKey | NFAIOOKNXAXEBY-UHFFFAOYSA-N |
SMILES | C1=CC2=C(NN=C2C=C1)CO |