For research use only. Not for therapeutic Use.
(1H-Indazol-4-YL)methanol is a heterocyclic compound featuring an indazole core with a hydroxymethyl group attached at the 4-position. This structure offers versatility in organic synthesis, allowing it to act as a key intermediate in the production of pharmaceutical compounds and biologically active molecules. Its indazole framework is known for contributing to a range of bioactivities, including anti-inflammatory and anticancer properties, making this compound valuable for medicinal chemistry research and drug development.
CAS Number | 709608-85-5 |
Molecular Formula | C8H8N2O |
Purity | ≥95% |
IUPAC Name | 1H-indazol-4-ylmethanol |
InChI | InChI=1S/C8H8N2O/c11-5-6-2-1-3-8-7(6)4-9-10-8/h1-4,11H,5H2,(H,9,10) |
InChIKey | LOOWJTAKSUNLSR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |