For research use only. Not for therapeutic Use.
1H-Indole-2,3-dione(Cat No.:R019412), is a chemical compound commonly known as isatin. It is an indole derivative with a ketone functional group at positions 2 and 3 of the indole ring. Isatin has diverse applications in organic synthesis and serves as a key starting material for the preparation of various pharmaceuticals, dyes, and other valuable compounds. Additionally, isatin and its derivatives have demonstrated a range of biological activities, making them of interest in medicinal chemistry and drug discovery research.
CAS Number | 91-56-5 |
Synonyms | Indole-2,3-dione; 2,3-Dihydro-1H-indole-2,3-dione; 2,3-Dihydroindole-2,3-dione; 2,3-Diketoindoline; 2,3-Dioxo-2,3-dihydroindole; 2,3-Dioxoindoline; 2,3-Indolindione; 2,3-Indolinedione; Isatic Acid Lactam; Isatin; Isatine; Isatinic Acid Anhydride; NSC |
Molecular Formula | C8H5NO2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 1H-indole-2,3-dione |
InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11) |
InChIKey | JXDYKVIHCLTXOP-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |