For research use only. Not for therapeutic Use.
1H-Indole-4-carbohydrazide(CAT: L034617) is an indole derivative with a carbohydrazide group at the 4-position, making it a valuable compound in medicinal chemistry. The indole ring provides a stable, aromatic scaffold known for bioactivity, while the carbohydrazide group enhances its reactivity and allows for further functionalization. This compound is commonly used in the synthesis of bioactive molecules, including enzyme inhibitors, anticancer agents, and antimicrobial compounds, owing to the indole’s ability to interact with various biological targets. In pharmaceutical research, it can serve as a versatile intermediate for developing compounds with improved binding affinity, specificity, and pharmacokinetic properties.
CAS Number | 885272-22-0 |
Molecular Formula | C9H9N3O |
Purity | ≥95% |
IUPAC Name | 1H-indole-4-carbohydrazide |
InChI | InChI=1S/C9H9N3O/c10-12-9(13)7-2-1-3-8-6(7)4-5-11-8/h1-5,11H,10H2,(H,12,13) |
InChIKey | VFWVCNABVVHCKS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |