For research use only. Not for therapeutic Use.
1H-Indole-6-methanamine(Cat No.:L019489)is an important organic compound widely used in pharmaceutical and chemical research. Featuring an indole ring with a methanamine group at the 6-position, this compound serves as a crucial building block in the synthesis of complex molecules, particularly in drug development. Its unique structure allows for versatile chemical transformations, making it valuable for creating various derivatives. 1H-Indole-6-methanamine plays a significant role in medicinal chemistry, contributing to the advancement of new therapeutic agents and high-precision research in synthetic chemistry.
CAS Number | 3468-17-5 |
Molecular Formula | C9H10N2 |
Purity | ≥95% |
IUPAC Name | 1H-indol-6-ylmethanamine |
InChI | InChI=1S/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
InChIKey | FURRUNQWZZOXOT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=C1C=CN2)CN |