For research use only. Not for therapeutic Use.
1H-Naphth[2,3-d]imidazol-2-amine (9CI)(CAT: M001174) is a fused heterocyclic compound featuring both naphthalene and imidazole structures, commonly used in pharmaceutical and biochemical research. The unique framework of this compound, with an imidazole ring fused to a naphthalene core, provides distinctive electronic properties that make it suitable for binding interactions in various biological systems. Often explored for its potential bioactivity, 1H-Naphth[2,3-d]imidazol-2-amine is a valuable intermediate in the synthesis of complex molecules aimed at therapeutic applications, particularly in the areas of anticancer, antimicrobial, and enzyme inhibition studies. Its structure allows for further functionalization, enhancing its versatility in drug design and development.
CAS Number | 102408-31-1 |
Molecular Formula | C11H9N3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1H-benzo[f]benzimidazol-2-amine |
InChI | InChI=1S/C11H9N3/c12-11-13-9-5-7-3-1-2-4-8(7)6-10(9)14-11/h1-6H,(H3,12,13,14) |
InChIKey | PKAMQIFKTSHCLX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C3C(=CC2=C1)NC(=N3)N |