For research use only. Not for therapeutic Use.
1H-Pyrazolo[4,3-c]pyridin-3-ol is a heterocyclic compound featuring a fused pyrazole and pyridine ring system, with a hydroxyl group (-OH) at the third position. Its chemical formula is C₇H₅N₃O. This compound is notable for its potential biological activities, including antitumor and anti-inflammatory effects, making it of interest in medicinal chemistry. The unique structural framework allows for diverse interactions with biological targets, enhancing its prospects in drug development and synthetic organic chemistry applications.
CAS Number | 3268-73-3 |
Molecular Formula | C6H5N3O |
Purity | ≥95% |
IUPAC Name | 1,2-dihydropyrazolo[4,3-c]pyridin-3-one |
InChI | InChI=1S/C6H5N3O/c10-6-4-3-7-2-1-5(4)8-9-6/h1-3H,(H2,8,9,10) |
InChIKey | REJIEQCCTGTBQO-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C1NNC2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |