For research use only. Not for therapeutic Use.
1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 1-methyl- (9CI)(Cat No.:M035969)is a heterocyclic compound used in pharmaceutical and chemical research. Featuring a pyrrolopyridine core with a methyl group at the 1-position and a carboxaldehyde group at the 3-position, this compound is a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective chemical reactions, making it useful in the development of therapeutic agents targeting various diseases. Additionally, it plays a role in the synthesis of complex organic compounds and fine chemicals, contributing to advancements in medicinal chemistry.
CAS Number | 171919-36-1 |
Molecular Formula | C9H8N2O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-methylpyrrolo[2,3-b]pyridine-3-carbaldehyde |
InChI | InChI=1S/C9H8N2O/c1-11-5-7(6-12)8-3-2-4-10-9(8)11/h2-6H,1H3 |
InChIKey | IZPRBMBNUDLUMD-UHFFFAOYSA-N |
SMILES | CN1C=C(C2=C1N=CC=C2)C=O |