For research use only. Not for therapeutic Use.
1H-Pyrrolo[2,3-c]pyridine-2-carboxylic acid(Cat No.:L040617)is a heterocyclic compound used in pharmaceutical and chemical research. This molecule features a fused pyrrole and pyridine ring system with a carboxylic acid group at the 2-position, making it a valuable intermediate in the synthesis of complex bioactive molecules. It is often employed in the development of potential therapeutic agents, particularly in drug discovery and medicinal chemistry. Its unique structure allows for diverse chemical modifications, supporting the creation of novel compounds with specific biological activities.
CAS Number | 24334-20-1 |
Molecular Formula | C8H6N2O2 |
Purity | ≥95% |
IUPAC Name | 1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
InChI | InChI=1S/C8H6N2O2/c11-8(12)6-3-5-1-2-9-4-7(5)10-6/h1-4,10H,(H,11,12) |
InChIKey | PWWYFIZEQHFRJH-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C1C=C(N2)C(=O)O |