For research use only. Not for therapeutic Use.
1H,1H,2H,2H-Perfluorodecylamine(Cat No.:L006850), is a fluorinated organic compound used in various applications, such as surface modifications, lubricants, and nanotechnology. Its unique structure includes a perfluorinated decyl chain attached to an amino group. The perfluorinated nature of the compound provides exceptional hydrophobicity and oleophobicity, making it valuable for creating water- and oil-repellent surfaces. Researchers utilize it in the synthesis of specialized coatings, adhesives, and materials with specific surface properties.
CAS Number | 30670-30-5 |
Molecular Formula | C10H6F17N |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-amine |
InChI | InChI=1S/C10H6F17N/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1-2,28H2 |
InChIKey | PFINVJYJNJHTFY-UHFFFAOYSA-N |
SMILES | C(CN)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |