For research use only. Not for therapeutic Use.
1H,1H,8H,8H-Octafluoro-3,6-dioxaoctane-1,8-diol(Cat No.:M116794), also known as perfluoropolyether diol (PFPE diol), is a fluorinated compound with unique properties that make it valuable in various applications. Its structure, with eight fluorine atoms and a dioxane ring, gives it exceptional stability, chemical inertness, and resistance to heat and solvents. These properties make PFPE diol a popular choice in the production of lubricants, coatings, and surfactants for use in extreme environments where traditional materials would fail.
CAS Number | 129301-42-4 |
Molecular Formula | C6H6F8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol |
InChI | InChI=1S/C6H6F8O4/c7-3(8,1-15)17-5(11,12)6(13,14)18-4(9,10)2-16/h15-16H,1-2H2 |
InChIKey | CWIAFBQLWOMNFY-UHFFFAOYSA-N |
SMILES | C(C(OC(C(OC(CO)(F)F)(F)F)(F)F)(F)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |