For research use only. Not for therapeutic Use.
(1R)-1-(4-nitrophenyl)ethan-1-ol(Cat No.:L006697), is a chiral compound featuring a nitrophenyl group attached to a chiral ethyl alcohol backbone. This enantiomerically pure compound is valuable in organic synthesis and drug discovery due to its stereochemistry. Chirality plays a critical role in its interactions with biological systems, making it essential in pharmaceutical research. Researchers often utilize this compound as a key intermediate in the synthesis of various pharmaceuticals and fine chemicals. Its specific structure and chiral properties enable the creation of targeted molecules, contributing significantly to advancements in drug development and the understanding of stereochemistry in biological processes.
CAS Number | 58287-18-6 |
Molecular Formula | C8H9NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (1R)-1-(4-nitrophenyl)ethanol |
InChI | InChI=1S/C8H9NO3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6,10H,1H3/t6-/m1/s1 |
InChIKey | CRJFHXYELTYDSG-ZCFIWIBFSA-N |
SMILES | CC(C1=CC=C(C=C1)[N+](=O)[O-])O |