For research use only. Not for therapeutic Use.
(1R)-1-(Thiophen-2-yl)ethan-1-amine(Cat No.:L010636)is a chiral amine widely used in pharmaceutical and organic synthesis. Featuring a thiophene ring attached to an ethanamine group with the (1R) configuration, this compound is a valuable intermediate in the development of enantiomerically pure drugs, particularly those targeting neurological and metabolic disorders. Its chiral center allows for the selective synthesis of specific enantiomers, making it crucial in medicinal chemistry for designing drugs with improved efficacy and reduced side effects. Additionally, it is used in the synthesis of complex organic molecules and advanced materials.
CAS Number | 22038-88-6 |
Molecular Formula | C6H9NS |
Purity | ≥95% |
IUPAC Name | (1R)-1-thiophen-2-ylethanamine |
InChI | InChI=1S/C6H9NS/c1-5(7)6-3-2-4-8-6/h2-5H,7H2,1H3/t5-/m1/s1 |
InChIKey | LYJBVRVJQXVVPI-RXMQYKEDSA-N |
SMILES | CC(C1=CC=CS1)N |